C9H10FNS — CID 10130247
6-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine (PubChem CID 10130247) has the molecular formula C9H10FNS and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine.
| Compound Name | 6-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 10130247 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-fluoro-2,3,4,5-tetrahydro-1,4-benzothiazepine |
| SMILES | Fc1cccc2c1CNCCS2 |
| InChI | InChI=1S/C9H10FNS/c10-8-2-1-3-9-7(8)6-11-4-5-12-9/h1-3,11H,4-6H2 |
| InChIKey | YAZUSGHZMAPMQE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |