C13H27N — CID 10130368
3,3,5,5-tetramethyl-1-propylcyclohexan-1-amine (PubChem CID 10130368) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-propylcyclohexan-1-amine.
| Compound Name | 3,3,5,5-tetramethyl-1-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10130368 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-propylcyclohexan-1-amine |
| SMILES | CCCC1(N)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H27N/c1-6-7-13(14)9-11(2,3)8-12(4,5)10-13/h6-10,14H2,1-5H3 |
| InChIKey | OMYKWZGACJRFAJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |