About 1-non-8-enylnaphthalene
1-non-8-enylnaphthalene (PubChem CID 101304361) has the molecular formula C19H24
and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-non-8-enylnaphthalene.
Molecular Properties
| Compound Name | 1-non-8-enylnaphthalene |
| PubChem CID | 101304361 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 1-non-8-enylnaphthalene |
| SMILES | C=CCCCCCCCc1cccc2ccccc12 |
| InChI | InChI=1S/C19H24/c1-2-3-4-5-6-7-8-12-17-14-11-15-18-13-9-10-16-19(17)18/h2,9-11,13-16H,1,3-8,12H2 |
| InChIKey | CYITZMYNVGYSGW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-non-8-enylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-non-8-enylnaphthalene?
The IUPAC name of 1-non-8-enylnaphthalene (CID 101304361) is 1-non-8-enylnaphthalene.
What is the SMILES notation for 1-non-8-enylnaphthalene?
The canonical SMILES for 1-non-8-enylnaphthalene is C=CCCCCCCCc1cccc2ccccc12.
What is the InChIKey of 1-non-8-enylnaphthalene?
The InChIKey is CYITZMYNVGYSGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24/c1-2-3-4-5-6-7-8-12-17-14-11-15-18-13-9-10-16-19(17)18/h2,9-11,13-16H,1,3-8,12H2.
What are the key properties of 1-non-8-enylnaphthalene?
1-non-8-enylnaphthalene has a molecular weight of 252.40 g/mol, XLogP of 5.91, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-non-8-enylnaphthalene is sourced from PubChem (CID 101304361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).