C20H26O3 — CID 101306708
(3S,8R,9S,10R,17S)-17-acetyl-3-hydroxy-10-methyl-2,3,4,7,8,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-one (PubChem CID 101306708) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (3S,8R,9S,10R,17S)-17-acetyl-3-hydroxy-10-methyl-2,3,4,7,8,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-one.
| Compound Name | (3S,8R,9S,10R,17S)-17-acetyl-3-hydroxy-10-methyl-2,3,4,7,8,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-one |
|---|---|
| PubChem CID | 101306708 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3S,8R,9S,10R,17S)-17-acetyl-3-hydroxy-10-methyl-2,3,4,7,8,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-one |
| SMILES | CC(=O)[C@H]1CCC2=C1C(=O)C[C@H]1[C@H]2CC=C2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C20H26O3/c1-11(21)14-5-6-16-15-4-3-12-9-13(22)7-8-20(12,2)17(15)10-18(23)19(14)16/h3,13-15,17,22H,4-10H2,1-2H3/t13-,14+,15-,17-,20-/m0/s1 |
| InChIKey | AAKYADOUWNFWOI-KXCAHRFWSA-N |
| XLogP | 3.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|