C18H20O7 — CID 101306743
(3R,7E,9R,10R,11S)-9,10-diethyl-11-hydroxy-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone (PubChem CID 101306743) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is (3R,7E,9R,10R,11S)-9,10-diethyl-11-hydroxy-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone.
| Compound Name | (3R,7E,9R,10R,11S)-9,10-diethyl-11-hydroxy-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 101306743 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | (3R,7E,9R,10R,11S)-9,10-diethyl-11-hydroxy-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone |
| SMILES | CC[C@H]1[C@H](O)C2=C(C[C@@]3(C)C(=O)OC(=O)/C3=C/[C@H]1CC)C(=O)OC2=O |
| InChI | InChI=1S/C18H20O7/c1-4-8-6-11-15(21)25-17(23)18(11,3)7-10-12(13(19)9(8)5-2)16(22)24-14(10)20/h6,8-9,13,19H,4-5,7H2,1-3H3/b11-6-/t8-,9-,13+,18-/m1/s1 |
| InChIKey | VERYNZFRBNJXKD-SXWBHPAMSA-N |
| XLogP | 1.20 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|