About 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione
3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione (PubChem CID 10130822) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione |
| PubChem CID | 10130822 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione |
| SMILES | CCC1NC(=O)C(c2cc(C)ccc2C)C1=O |
| InChI | InChI=1S/C14H17NO2/c1-4-11-13(16)12(14(17)15-11)10-7-8(2)5-6-9(10)3/h5-7,11-12H,4H2,1-3H3,(H,15,17) |
| InChIKey | FUDDMLNTJKZPKP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione?
The IUPAC name of 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione (CID 10130822) is 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione.
What is the SMILES notation for 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione?
The canonical SMILES for 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione is CCC1NC(=O)C(c2cc(C)ccc2C)C1=O.
What is the InChIKey of 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione?
The InChIKey is FUDDMLNTJKZPKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-4-11-13(16)12(14(17)15-11)10-7-8(2)5-6-9(10)3/h5-7,11-12H,4H2,1-3H3,(H,15,17).
What are the key properties of 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione?
3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione has a molecular weight of 231.29 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylphenyl)-5-ethylpyrrolidine-2,4-dione is sourced from PubChem (CID 10130822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).