About 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene
3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene (PubChem CID 10130958) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene |
| PubChem CID | 10130958 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene |
| SMILES | COC1(OC)CCc2cc(SC)ccc2C1 |
| InChI | InChI=1S/C13H18O2S/c1-14-13(15-2)7-6-10-8-12(16-3)5-4-11(10)9-13/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | ZIGRHDBFOUUPCC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene?
The IUPAC name of 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene (CID 10130958) is 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene.
What is the SMILES notation for 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene?
The canonical SMILES for 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene is COC1(OC)CCc2cc(SC)ccc2C1.
What is the InChIKey of 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene?
The InChIKey is ZIGRHDBFOUUPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-14-13(15-2)7-6-10-8-12(16-3)5-4-11(10)9-13/h4-5,8H,6-7,9H2,1-3H3.
What are the key properties of 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene?
3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene has a molecular weight of 238.35 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethoxy-7-methylsulfanyl-2,4-dihydro-1H-naphthalene is sourced from PubChem (CID 10130958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).