C10H9NO6S2 — CID 101310221
2-aminonaphthalene-1,8-disulfonic acid (PubChem CID 101310221) has the molecular formula C10H9NO6S2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-aminonaphthalene-1,8-disulfonic acid.
| Compound Name | 2-aminonaphthalene-1,8-disulfonic acid |
|---|---|
| PubChem CID | 101310221 |
| Molecular Formula | C10H9NO6S2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 2-aminonaphthalene-1,8-disulfonic acid |
| SMILES | Nc1ccc2cccc(S(=O)(=O)O)c2c1S(=O)(=O)O |
| InChI | InChI=1S/C10H9NO6S2/c11-7-5-4-6-2-1-3-8(18(12,13)14)9(6)10(7)19(15,16)17/h1-5H,11H2,(H,12,13,14)(H,15,16,17) |
| InChIKey | HGPNYHCCQHOKAS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|