About [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite
[4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite (PubChem CID 101312041) has the molecular formula C47H94O6P2
and a molecular weight of 817.21 g/mol. Its IUPAC name is [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite.
Molecular Properties
| Compound Name | [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite |
| PubChem CID | 101312041 |
| Molecular Formula | C47H94O6P2 |
| Molecular Weight | 817.21 g/mol |
| Exact Mass | 816.65 |
| IUPAC Name | [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite |
| SMILES | CCCCCCCCOP(OCCCCCCCC)OC1CCC(C(C)(C)C2CCC(OP(OCCCCCCCC)OCCCCCCCC)CC2)CC1 |
| InChI | InChI=1S/C47H94O6P2/c1-7-11-15-19-23-27-39-48-54(49-40-28-24-20-16-12-8-2)52-45-35-31-43(32-36-45)47(5,6)44-33-37-46(38-34-44)53-55(50-41-29-25-21-17-13-9-3)51-42-30-26-22-18-14-10-4/h43-46H,7-42H2,1-6H3 |
| InChIKey | UYFPWYCBVLLRTH-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 817.21 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite?
The IUPAC name of [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite (CID 101312041) is [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite.
What is the SMILES notation for [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite?
The canonical SMILES for [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite is CCCCCCCCOP(OCCCCCCCC)OC1CCC(C(C)(C)C2CCC(OP(OCCCCCCCC)OCCCCCCCC)CC2)CC1.
What is the InChIKey of [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite?
The InChIKey is UYFPWYCBVLLRTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H94O6P2/c1-7-11-15-19-23-27-39-48-54(49-40-28-24-20-16-12-8-2)52-45-35-31-43(32-36-45)47(5,6)44-33-37-46(38-34-44)53-55(50-41-29-25-21-17-13-9-3)51-42-30-26-22-18-14-10-4/h43-46H,7-42H2,1-6H3.
What are the key properties of [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite?
[4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite has a molecular weight of 817.21 g/mol, XLogP of 17.13, 38 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-dioctoxyphosphanyloxycyclohexyl)propan-2-yl]cyclohexyl] dioctyl phosphite is sourced from PubChem (CID 101312041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).