About 2,6-diethylcyclohexen-1-ol
2,6-diethylcyclohexen-1-ol (PubChem CID 101312088) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,6-diethylcyclohexen-1-ol.
Molecular Properties
| Compound Name | 2,6-diethylcyclohexen-1-ol |
| PubChem CID | 101312088 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2,6-diethylcyclohexen-1-ol |
| SMILES | CCC1=C(O)C(CC)CCC1 |
| InChI | InChI=1S/C10H18O/c1-3-8-6-5-7-9(4-2)10(8)11/h8,11H,3-7H2,1-2H3 |
| InChIKey | UBZLKTFKQJTQMW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-diethylcyclohexen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethylcyclohexen-1-ol?
The IUPAC name of 2,6-diethylcyclohexen-1-ol (CID 101312088) is 2,6-diethylcyclohexen-1-ol.
What is the SMILES notation for 2,6-diethylcyclohexen-1-ol?
The canonical SMILES for 2,6-diethylcyclohexen-1-ol is CCC1=C(O)C(CC)CCC1.
What is the InChIKey of 2,6-diethylcyclohexen-1-ol?
The InChIKey is UBZLKTFKQJTQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-3-8-6-5-7-9(4-2)10(8)11/h8,11H,3-7H2,1-2H3.
What are the key properties of 2,6-diethylcyclohexen-1-ol?
2,6-diethylcyclohexen-1-ol has a molecular weight of 154.25 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethylcyclohexen-1-ol is sourced from PubChem (CID 101312088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).