C7H12NO7P — CID 10131225
4-(phosphonomethyl)pyrrolidine-2,4-dicarboxylic acid (PubChem CID 10131225) has the molecular formula C7H12NO7P and a molecular weight of 253.15 g/mol. Its IUPAC name is 4-(phosphonomethyl)pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | 4-(phosphonomethyl)pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 10131225 |
| Molecular Formula | C7H12NO7P |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4-(phosphonomethyl)pyrrolidine-2,4-dicarboxylic acid |
| SMILES | O=C(O)C1CC(CP(=O)(O)O)(C(=O)O)CN1 |
| InChI | InChI=1S/C7H12NO7P/c9-5(10)4-1-7(2-8-4,6(11)12)3-16(13,14)15/h4,8H,1-3H2,(H,9,10)(H,11,12)(H2,13,14,15) |
| InChIKey | PLDGZMHHFNHLJI-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|