C20H30O2 — CID 101312689
2-[[3-[(E)-undec-7-enyl]phenoxy]methyl]oxirane (PubChem CID 101312689) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-[[3-[(E)-undec-7-enyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[3-[(E)-undec-7-enyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 101312689 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-[[3-[(E)-undec-7-enyl]phenoxy]methyl]oxirane |
| SMILES | CCC/C=C/CCCCCCc1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-12-18-13-11-14-19(15-18)21-16-20-17-22-20/h4-5,11,13-15,20H,2-3,6-10,12,16-17H2,1H3/b5-4+ |
| InChIKey | UPFZRCAWLUAGLI-SNAWJCMRSA-N |
| XLogP | 5.31 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|