About 3-piperidin-1-ylpropyl N-pentylcarbamate
3-piperidin-1-ylpropyl N-pentylcarbamate (PubChem CID 10131310) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl N-pentylcarbamate.
Molecular Properties
| Compound Name | 3-piperidin-1-ylpropyl N-pentylcarbamate |
| PubChem CID | 10131310 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 3-piperidin-1-ylpropyl N-pentylcarbamate |
| SMILES | CCCCCNC(=O)OCCCN1CCCCC1 |
| InChI | InChI=1S/C14H28N2O2/c1-2-3-5-9-15-14(17)18-13-8-12-16-10-6-4-7-11-16/h2-13H2,1H3,(H,15,17) |
| InChIKey | VXLSFCKPAGUEFA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-ylpropyl N-pentylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylpropyl N-pentylcarbamate?
The IUPAC name of 3-piperidin-1-ylpropyl N-pentylcarbamate (CID 10131310) is 3-piperidin-1-ylpropyl N-pentylcarbamate.
What is the SMILES notation for 3-piperidin-1-ylpropyl N-pentylcarbamate?
The canonical SMILES for 3-piperidin-1-ylpropyl N-pentylcarbamate is CCCCCNC(=O)OCCCN1CCCCC1.
What is the InChIKey of 3-piperidin-1-ylpropyl N-pentylcarbamate?
The InChIKey is VXLSFCKPAGUEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-2-3-5-9-15-14(17)18-13-8-12-16-10-6-4-7-11-16/h2-13H2,1H3,(H,15,17).
What are the key properties of 3-piperidin-1-ylpropyl N-pentylcarbamate?
3-piperidin-1-ylpropyl N-pentylcarbamate has a molecular weight of 256.39 g/mol, XLogP of 2.78, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylpropyl N-pentylcarbamate is sourced from PubChem (CID 10131310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).