About 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one
7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one (PubChem CID 10131333) has the molecular formula C16H11N3O3S
and a molecular weight of 325.35 g/mol. Its IUPAC name is 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one |
| PubChem CID | 10131333 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one |
| SMILES | COc1cc2[nH]c(-c3cscn3)cc(=O)c2cc1-c1cnco1 |
| InChI | InChI=1S/C16H11N3O3S/c1-21-15-4-11-9(2-10(15)16-5-17-7-22-16)14(20)3-12(19-11)13-6-23-8-18-13/h2-8H,1H3,(H,19,20) |
| InChIKey | RAKSNQZFBDNSBW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one?
The IUPAC name of 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one (CID 10131333) is 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one.
What is the SMILES notation for 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one?
The canonical SMILES for 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one is COc1cc2[nH]c(-c3cscn3)cc(=O)c2cc1-c1cnco1.
What is the InChIKey of 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one?
The InChIKey is RAKSNQZFBDNSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O3S/c1-21-15-4-11-9(2-10(15)16-5-17-7-22-16)14(20)3-12(19-11)13-6-23-8-18-13/h2-8H,1H3,(H,19,20).
What are the key properties of 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one?
7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one has a molecular weight of 325.35 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-6-(1,3-oxazol-5-yl)-2-(1,3-thiazol-4-yl)-1H-quinolin-4-one is sourced from PubChem (CID 10131333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).