About (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine
(2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine (PubChem CID 10131410) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine.
Molecular Properties
| Compound Name | (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine |
| PubChem CID | 10131410 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.O=C1C[C@@H](C(=O)O)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C11H10O4.C8H11N/c12-9-6-8(11(13)14)10(15-9)7-4-2-1-3-5-7;1-7(9)8-5-3-2-4-6-8/h1-5,8,10H,6H2,(H,13,14);2-7H,9H2,1H3/t8-,10+;/m1./s1 |
| InChIKey | PEKUFLDZTYUGFE-SCYNACPDSA-N |
| XLogP | 3.08 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine?
The IUPAC name of (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine (CID 10131410) is (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine.
What is the SMILES notation for (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine?
The canonical SMILES for (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine is CC(N)c1ccccc1.O=C1C[C@@H](C(=O)O)[C@H](c2ccccc2)O1.
What is the InChIKey of (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine?
The InChIKey is PEKUFLDZTYUGFE-SCYNACPDSA-N. The full InChI is InChI=1S/C11H10O4.C8H11N/c12-9-6-8(11(13)14)10(15-9)7-4-2-1-3-5-7;1-7(9)8-5-3-2-4-6-8/h1-5,8,10H,6H2,(H,13,14);2-7H,9H2,1H3/t8-,10+;/m1./s1.
What are the key properties of (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine?
(2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine has a molecular weight of 327.38 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-5-oxo-2-phenyloxolane-3-carboxylic acid;1-phenylethanamine is sourced from PubChem (CID 10131410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).