About 3-(didecylamino)hexanoic acid
3-(didecylamino)hexanoic acid (PubChem CID 101314409) has the molecular formula C26H53NO2
and a molecular weight of 411.72 g/mol. Its IUPAC name is 3-(didecylamino)hexanoic acid.
Molecular Properties
| Compound Name | 3-(didecylamino)hexanoic acid |
| PubChem CID | 101314409 |
| Molecular Formula | C26H53NO2 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.41 |
| IUPAC Name | 3-(didecylamino)hexanoic acid |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(CCC)CC(=O)O |
| InChI | InChI=1S/C26H53NO2/c1-4-7-9-11-13-15-17-19-22-27(25(21-6-3)24-26(28)29)23-20-18-16-14-12-10-8-5-2/h25H,4-24H2,1-3H3,(H,28,29) |
| InChIKey | UPPBPPHUELEPBD-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(didecylamino)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(didecylamino)hexanoic acid?
The IUPAC name of 3-(didecylamino)hexanoic acid (CID 101314409) is 3-(didecylamino)hexanoic acid.
What is the SMILES notation for 3-(didecylamino)hexanoic acid?
The canonical SMILES for 3-(didecylamino)hexanoic acid is CCCCCCCCCCN(CCCCCCCCCC)C(CCC)CC(=O)O.
What is the InChIKey of 3-(didecylamino)hexanoic acid?
The InChIKey is UPPBPPHUELEPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H53NO2/c1-4-7-9-11-13-15-17-19-22-27(25(21-6-3)24-26(28)29)23-20-18-16-14-12-10-8-5-2/h25H,4-24H2,1-3H3,(H,28,29).
What are the key properties of 3-(didecylamino)hexanoic acid?
3-(didecylamino)hexanoic acid has a molecular weight of 411.72 g/mol, XLogP of 8.21, 23 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(didecylamino)hexanoic acid is sourced from PubChem (CID 101314409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).