sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate

C26H45NaO4S — CID 101315804

IUPACsodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate
SMILESCCCCCCCCc1cccc(CCCCCCCC)c1OCC(CC)S(=O)(=O)[O-].[Na+]
InChIInChI=1S/C26H46O4S.Na/c1-4-7-9-11-13-15-18-23-20-17-21-24(19-16-14-12-10-8-5-2)26(23)30-22-25(6-3)31(27,28)29;/h17,20-21,25H,4-16,18-19,22H2,1-3H3,(H,27,28,29);/q;+1/p-1
InChIKeyUYILGHZTDSWNIT-UHFFFAOYSA-M
MW476.70 g/mol
LogP4.20
Rot. Bonds19

About sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate

sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate (PubChem CID 101315804) has the molecular formula C26H45NaO4S and a molecular weight of 476.70 g/mol. Its IUPAC name is sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate.

Molecular Properties

Compound Namesodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate
PubChem CID101315804
Molecular FormulaC26H45NaO4S
Molecular Weight476.70 g/mol
Exact Mass476.29
IUPAC Namesodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate
SMILESCCCCCCCCc1cccc(CCCCCCCC)c1OCC(CC)S(=O)(=O)[O-].[Na+]
InChIInChI=1S/C26H46O4S.Na/c1-4-7-9-11-13-15-18-23-20-17-21-24(19-16-14-12-10-8-5-2)26(23)30-22-25(6-3)31(27,28)29;/h17,20-21,25H,4-16,18-19,22H2,1-3H3,(H,27,28,29);/q;+1/p-1
InChIKeyUYILGHZTDSWNIT-UHFFFAOYSA-M
XLogP4.20
TPSA66.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds19
Heavy Atoms32
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500476.70
LogP ≤ 54.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate?
The IUPAC name of sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate (CID 101315804) is sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate.
What is the SMILES notation for sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate?
The canonical SMILES for sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate is CCCCCCCCc1cccc(CCCCCCCC)c1OCC(CC)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate?
The InChIKey is UYILGHZTDSWNIT-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H46O4S.Na/c1-4-7-9-11-13-15-18-23-20-17-21-24(19-16-14-12-10-8-5-2)26(23)30-22-25(6-3)31(27,28)29;/h17,20-21,25H,4-16,18-19,22H2,1-3H3,(H,27,28,29);/q;+1/p-1.
What are the key properties of sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate?
sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate has a molecular weight of 476.70 g/mol, XLogP of 4.20, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-(2,6-dioctylphenoxy)butane-2-sulfonate is sourced from PubChem (CID 101315804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).