C24H13F25N2O2 — CID 101316086
4-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-yl)benzamide (PubChem CID 101316086) has the molecular formula C24H13F25N2O2 and a molecular weight of 836.33 g/mol. Its IUPAC name is 4-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-yl)benzamide.
| Compound Name | 4-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-yl)benzamide |
|---|---|
| PubChem CID | 101316086 |
| Molecular Formula | C24H13F25N2O2 |
| Molecular Weight | 836.33 g/mol |
| Exact Mass | 836.06 |
| IUPAC Name | 4-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-yl)benzamide |
| SMILES | Cc1cc(N=C=O)ccc1C(=O)NC(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H13F25N2O2/c1-8-5-10(50-7-52)3-4-11(8)12(53)51-9(2)6-13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)18(35,36)19(37,38)20(39,40)21(41,42)22(43,44)23(45,46)24(47,48)49/h3-5,9H,6H2,1-2H3,(H,51,53) |
| InChIKey | GMYAGQBASUTQAW-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.33 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|