C45H86O8 — CID 101316470
(6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-6,10,34-triene-1,2,3,15,19,23,27,31-octol (PubChem CID 101316470) has the molecular formula C45H86O8 and a molecular weight of 755.17 g/mol. Its IUPAC name is (6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-6,10,34-triene-1,2,3,15,19,23,27,31-octol.
| Compound Name | (6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-6,10,34-triene-1,2,3,15,19,23,27,31-octol |
|---|---|
| PubChem CID | 101316470 |
| Molecular Formula | C45H86O8 |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.63 |
| IUPAC Name | (6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-6,10,34-triene-1,2,3,15,19,23,27,31-octol |
| SMILES | CC(C)=CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC/C(C)=C/CC/C(C)=C/CCC(C)(O)C(O)CO |
| InChI | InChI=1S/C45H86O8/c1-36(2)19-12-24-40(5,48)26-15-28-42(7,50)30-17-32-44(9,52)33-18-31-43(8,51)29-16-27-41(6,49)25-13-22-37(3)20-11-21-38(4)23-14-34-45(10,53)39(47)35-46/h19-20,23,39,46-53H,11-18,21-22,24-35H2,1-10H3/b37-20+,38-23+ |
| InChIKey | ODYQWBQQODHSHH-JZYBSQCASA-N |
| XLogP | 8.90 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|