C15H22O3 — CID 101316747
(1S,3aS,9S,9aS,9bR)-3a-hydroxy-1,9,9a-trimethyl-4,5,7,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-2-one (PubChem CID 101316747) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S,3aS,9S,9aS,9bR)-3a-hydroxy-1,9,9a-trimethyl-4,5,7,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-2-one.
| Compound Name | (1S,3aS,9S,9aS,9bR)-3a-hydroxy-1,9,9a-trimethyl-4,5,7,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 101316747 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1S,3aS,9S,9aS,9bR)-3a-hydroxy-1,9,9a-trimethyl-4,5,7,8,9,9b-hexahydro-1H-benzo[e][1]benzofuran-2-one |
| SMILES | C[C@@H]1C(=O)O[C@@]2(O)CCC3=CCC[C@H](C)[C@@]3(C)[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-9-5-4-6-11-7-8-15(17)12(14(9,11)3)10(2)13(16)18-15/h6,9-10,12,17H,4-5,7-8H2,1-3H3/t9-,10-,12+,14+,15-/m0/s1 |
| InChIKey | YRKNTNGCXCUPAE-JPXUEEETSA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|