C13H8O6 — CID 101316784
4-hydroxy-5-[(E)-2-(4-hydroxy-6-oxopyran-2-yl)ethenyl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 101316784) has the molecular formula C13H8O6 and a molecular weight of 260.20 g/mol. Its IUPAC name is 4-hydroxy-5-[(E)-2-(4-hydroxy-6-oxopyran-2-yl)ethenyl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-hydroxy-5-[(E)-2-(4-hydroxy-6-oxopyran-2-yl)ethenyl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 101316784 |
| Molecular Formula | C13H8O6 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-hydroxy-5-[(E)-2-(4-hydroxy-6-oxopyran-2-yl)ethenyl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=C(O)C(/C=C/c2cc(O)cc(=O)o2)=CC1=O |
| InChI | InChI=1S/C13H8O6/c14-8-4-9(19-13(18)5-8)2-1-7-3-11(16)12(17)6-10(7)15/h1-6,14-15H/b2-1+ |
| InChIKey | WPBJNSCNNIGOGZ-OWOJBTEDSA-N |
| XLogP | 0.88 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|