C31H50O3 — CID 101316867
(1R,4S,5S,10R,12R,13S,16R,17R)-13-[(2S,5R)-2,5-dimethyl-5-propan-2-yloxolan-2-yl]-1,5,16-trimethyl-4-prop-1-en-2-yl-9-oxatetracyclo[8.6.1.05,17.012,16]heptadecan-8-one (PubChem CID 101316867) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is (1R,4S,5S,10R,12R,13S,16R,17R)-13-[(2S,5R)-2,5-dimethyl-5-propan-2-yloxolan-2-yl]-1,5,16-trimethyl-4-prop-1-en-2-yl-9-oxatetracyclo[8.6.1.05,17.012,16]heptadecan-8-one.
| Compound Name | (1R,4S,5S,10R,12R,13S,16R,17R)-13-[(2S,5R)-2,5-dimethyl-5-propan-2-yloxolan-2-yl]-1,5,16-trimethyl-4-prop-1-en-2-yl-9-oxatetracyclo[8.6.1.05,17.012,16]heptadecan-8-one |
|---|---|
| PubChem CID | 101316867 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | (1R,4S,5S,10R,12R,13S,16R,17R)-13-[(2S,5R)-2,5-dimethyl-5-propan-2-yloxolan-2-yl]-1,5,16-trimethyl-4-prop-1-en-2-yl-9-oxatetracyclo[8.6.1.05,17.012,16]heptadecan-8-one |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)[C@@H]3[C@@H](C[C@@H]4[C@@H]([C@]5(C)CC[C@](C)(C(C)C)O5)CC[C@]42C)OC(=O)CC[C@]31C |
| InChI | InChI=1S/C31H50O3/c1-19(2)21-10-15-29(7)26-24(33-25(32)12-13-27(21,26)5)18-23-22(11-14-28(23,29)6)31(9)17-16-30(8,34-31)20(3)4/h20-24,26H,1,10-18H2,2-9H3/t21-,22-,23+,24+,26+,27-,28+,29+,30+,31-/m0/s1 |
| InChIKey | WCTXMXRKCIJXTQ-DTRPASCXSA-N |
| XLogP | 7.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|