About 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one
2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one (PubChem CID 10131872) has the molecular formula C18H28N2O2S
and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one.
Molecular Properties
| Compound Name | 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one |
| PubChem CID | 10131872 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCCCCCCCCNc1nc2sccc2c(=O)o1 |
| InChI | InChI=1S/C18H28N2O2S/c1-2-3-4-5-6-7-8-9-10-11-13-19-18-20-16-15(12-14-23-16)17(21)22-18/h12,14H,2-11,13H2,1H3,(H,19,20) |
| InChIKey | RMBOMTMSFYAKDC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one?
The IUPAC name of 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one (CID 10131872) is 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one.
What is the SMILES notation for 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one?
The canonical SMILES for 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one is CCCCCCCCCCCCNc1nc2sccc2c(=O)o1.
What is the InChIKey of 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one?
The InChIKey is RMBOMTMSFYAKDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O2S/c1-2-3-4-5-6-7-8-9-10-11-13-19-18-20-16-15(12-14-23-16)17(21)22-18/h12,14H,2-11,13H2,1H3,(H,19,20).
What are the key properties of 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one?
2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one has a molecular weight of 336.50 g/mol, XLogP of 5.58, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dodecylamino)thieno[2,3-d][1,3]oxazin-4-one is sourced from PubChem (CID 10131872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).