C14H11F6NO2 — CID 10131968
2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10131968) has the molecular formula C14H11F6NO2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10131968 |
| Molecular Formula | C14H11F6NO2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1noc(C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F6NO2/c1-7-11(8(2)23-21-7)9-3-5-10(6-4-9)12(22,13(15,16)17)14(18,19)20/h3-6,22H,1-2H3 |
| InChIKey | NWQJJKSOJASBHZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |