C11H26ClNSi2 — CID 101320209
1-(4-chlorobutyl)-2,2,6,6-tetramethyl-1,2,6-azadisilinane (PubChem CID 101320209) has the molecular formula C11H26ClNSi2 and a molecular weight of 263.96 g/mol. Its IUPAC name is 1-(4-chlorobutyl)-2,2,6,6-tetramethyl-1,2,6-azadisilinane.
| Compound Name | 1-(4-chlorobutyl)-2,2,6,6-tetramethyl-1,2,6-azadisilinane |
|---|---|
| PubChem CID | 101320209 |
| Molecular Formula | C11H26ClNSi2 |
| Molecular Weight | 263.96 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(4-chlorobutyl)-2,2,6,6-tetramethyl-1,2,6-azadisilinane |
| SMILES | C[Si]1(C)CCC[Si](C)(C)N1CCCCCl |
| InChI | InChI=1S/C11H26ClNSi2/c1-14(2)10-7-11-15(3,4)13(14)9-6-5-8-12/h5-11H2,1-4H3 |
| InChIKey | ZYFRNLUVMCUXNF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|