About 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol
4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol (PubChem CID 10132076) has the molecular formula C15H32O4S2
and a molecular weight of 340.55 g/mol. Its IUPAC name is 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol |
| PubChem CID | 10132076 |
| Molecular Formula | C15H32O4S2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol |
| SMILES | CC(C)(CO)CCS(=O)CCCS(=O)CCC(C)(C)CO |
| InChI | InChI=1S/C15H32O4S2/c1-14(2,12-16)6-10-20(18)8-5-9-21(19)11-7-15(3,4)13-17/h16-17H,5-13H2,1-4H3 |
| InChIKey | JXMKGHXZBJZSJF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol?
The IUPAC name of 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol (CID 10132076) is 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol.
What is the SMILES notation for 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol?
The canonical SMILES for 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol is CC(C)(CO)CCS(=O)CCCS(=O)CCC(C)(C)CO.
What is the InChIKey of 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol?
The InChIKey is JXMKGHXZBJZSJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O4S2/c1-14(2,12-16)6-10-20(18)8-5-9-21(19)11-7-15(3,4)13-17/h16-17H,5-13H2,1-4H3.
What are the key properties of 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol?
4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol has a molecular weight of 340.55 g/mol, XLogP of 1.69, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-hydroxy-3,3-dimethylbutyl)sulfinylpropylsulfinyl]-2,2-dimethylbutan-1-ol is sourced from PubChem (CID 10132076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).