About N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine
N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine (PubChem CID 10132111) has the molecular formula C16H18F3N3S
and a molecular weight of 341.40 g/mol. Its IUPAC name is N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine.
Molecular Properties
| Compound Name | N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine |
| PubChem CID | 10132111 |
| Molecular Formula | C16H18F3N3S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine |
| SMILES | Cn1nc(-c2ccc(C(F)(F)F)cc2)s/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C16H18F3N3S/c1-22-15(20-13-5-3-2-4-6-13)23-14(21-22)11-7-9-12(10-8-11)16(17,18)19/h7-10,13H,2-6H2,1H3/b20-15- |
| InChIKey | OQJJXPPIXOKSGH-HKWRFOASSA-N |
| XLogP | 4.40 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine?
The IUPAC name of N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine (CID 10132111) is N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine.
What is the SMILES notation for N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine?
The canonical SMILES for N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine is Cn1nc(-c2ccc(C(F)(F)F)cc2)s/c1=N\C1CCCCC1.
What is the InChIKey of N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine?
The InChIKey is OQJJXPPIXOKSGH-HKWRFOASSA-N. The full InChI is InChI=1S/C16H18F3N3S/c1-22-15(20-13-5-3-2-4-6-13)23-14(21-22)11-7-9-12(10-8-11)16(17,18)19/h7-10,13H,2-6H2,1H3/b20-15-.
What are the key properties of N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine?
N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine has a molecular weight of 341.40 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-3-methyl-5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-imine is sourced from PubChem (CID 10132111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).