C23H32O6 — CID 101321342
3-[(1R,3S,5R,7S,10S,11R,13R,14S,15R,18R)-7,13,18-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-15-yl]-2H-furan-5-one (PubChem CID 101321342) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-[(1R,3S,5R,7S,10S,11R,13R,14S,15R,18R)-7,13,18-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-15-yl]-2H-furan-5-one.
| Compound Name | 3-[(1R,3S,5R,7S,10S,11R,13R,14S,15R,18R)-7,13,18-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-15-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 101321342 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-[(1R,3S,5R,7S,10S,11R,13R,14S,15R,18R)-7,13,18-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-15-yl]-2H-furan-5-one |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1C[C@@H]1O[C@]13[C@@H]2C[C@@H](O)[C@]1(C)[C@@H](C2=CC(=O)OC2)CC[C@@]13O |
| InChI | InChI=1S/C23H32O6/c1-20-5-3-14(24)8-13(20)9-18-23(29-18)16(20)10-17(25)21(2)15(4-6-22(21,23)27)12-7-19(26)28-11-12/h7,13-18,24-25,27H,3-6,8-11H2,1-2H3/t13-,14+,15-,16-,17-,18+,20+,21+,22-,23-/m1/s1 |
| InChIKey | QTOGAWMQLUDPQK-MVDTUPGRSA-N |
| XLogP | 1.71 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|