About 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine
1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine (PubChem CID 101322830) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
| PubChem CID | 101322830 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine |
| SMILES | CCCCCC/C=C/C1N=CCN1C(C)N |
| InChI | InChI=1S/C13H25N3/c1-3-4-5-6-7-8-9-13-15-10-11-16(13)12(2)14/h8-10,12-13H,3-7,11,14H2,1-2H3/b9-8+ |
| InChIKey | HJBWWLBZEYQZRU-CMDGGOBGSA-N |
| XLogP | 2.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine?
The IUPAC name of 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine (CID 101322830) is 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine.
What is the SMILES notation for 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine?
The canonical SMILES for 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine is CCCCCC/C=C/C1N=CCN1C(C)N.
What is the InChIKey of 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine?
The InChIKey is HJBWWLBZEYQZRU-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H25N3/c1-3-4-5-6-7-8-9-13-15-10-11-16(13)12(2)14/h8-10,12-13H,3-7,11,14H2,1-2H3/b9-8+.
What are the key properties of 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine?
1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine has a molecular weight of 223.36 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(E)-oct-1-enyl]-2,4-dihydroimidazol-3-yl]ethanamine is sourced from PubChem (CID 101322830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).