C13H25N3 — CID 101322846
2-[2-[(E)-oct-3-enyl]-4,5-dihydroimidazol-1-yl]ethanamine (PubChem CID 101322846) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-[2-[(E)-oct-3-enyl]-4,5-dihydroimidazol-1-yl]ethanamine.
| Compound Name | 2-[2-[(E)-oct-3-enyl]-4,5-dihydroimidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 101322846 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-[2-[(E)-oct-3-enyl]-4,5-dihydroimidazol-1-yl]ethanamine |
| SMILES | CCCC/C=C/CCC1=NCCN1CCN |
| InChI | InChI=1S/C13H25N3/c1-2-3-4-5-6-7-8-13-15-10-12-16(13)11-9-14/h5-6H,2-4,7-12,14H2,1H3/b6-5+ |
| InChIKey | XJBAGGKGHJDBTC-AATRIKPKSA-N |
| XLogP | 2.19 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|