About methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate
methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate (PubChem CID 101323126) has the molecular formula C31H64O4Si2
and a molecular weight of 557.02 g/mol. Its IUPAC name is methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate.
Molecular Properties
| Compound Name | methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate |
| PubChem CID | 101323126 |
| Molecular Formula | C31H64O4Si2 |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate |
| SMILES | CCCCC/C=C\CC(O[Si](C)(C)C(C)(C)C)C(CCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O4Si2/c1-13-14-15-16-18-21-24-27(34-36(9,10)30(2,3)4)28(35-37(11,12)31(5,6)7)25-22-19-17-20-23-26-29(32)33-8/h18,21,27-28H,13-17,19-20,22-26H2,1-12H3/b21-18- |
| InChIKey | ZPGBMOYBPDWVGR-UZYVYHOESA-N |
| XLogP | 10.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate?
The IUPAC name of methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate (CID 101323126) is methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate.
What is the SMILES notation for methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate?
The canonical SMILES for methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate is CCCCC/C=C\CC(O[Si](C)(C)C(C)(C)C)C(CCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate?
The InChIKey is ZPGBMOYBPDWVGR-UZYVYHOESA-N. The full InChI is InChI=1S/C31H64O4Si2/c1-13-14-15-16-18-21-24-27(34-36(9,10)30(2,3)4)28(35-37(11,12)31(5,6)7)25-22-19-17-20-23-26-29(32)33-8/h18,21,27-28H,13-17,19-20,22-26H2,1-12H3/b21-18-.
What are the key properties of methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate?
methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate has a molecular weight of 557.02 g/mol, XLogP of 10.20, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-12-enoate is sourced from PubChem (CID 101323126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).