C18H23KO3S — CID 101323916
potassium 5,6-dibutylnaphthalene-2-sulfonate (PubChem CID 101323916) has the molecular formula C18H23KO3S and a molecular weight of 358.54 g/mol. Its IUPAC name is potassium 5,6-dibutylnaphthalene-2-sulfonate.
| Compound Name | potassium 5,6-dibutylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 101323916 |
| Molecular Formula | C18H23KO3S |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | potassium 5,6-dibutylnaphthalene-2-sulfonate |
| SMILES | CCCCc1ccc2cc(S(=O)(=O)[O-])ccc2c1CCCC.[K+] |
| InChI | InChI=1S/C18H24O3S.K/c1-3-5-7-14-9-10-15-13-16(22(19,20)21)11-12-18(15)17(14)8-6-4-2;/h9-13H,3-8H2,1-2H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | XXAAEOKQWIEBEA-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|