C21H25N5 — CID 10132445
12-cyclopentyl-10-ethyl-5-(2-methylphenyl)-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene (PubChem CID 10132445) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 12-cyclopentyl-10-ethyl-5-(2-methylphenyl)-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene.
| Compound Name | 12-cyclopentyl-10-ethyl-5-(2-methylphenyl)-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene |
|---|---|
| PubChem CID | 10132445 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 12-cyclopentyl-10-ethyl-5-(2-methylphenyl)-3,4,6,11,12-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,10-tetraene |
| SMILES | CCc1nn(C2CCCC2)c2c1CCn1c(-c3ccccc3C)nnc1-2 |
| InChI | InChI=1S/C21H25N5/c1-3-18-17-12-13-25-20(16-11-7-4-8-14(16)2)22-23-21(25)19(17)26(24-18)15-9-5-6-10-15/h4,7-8,11,15H,3,5-6,9-10,12-13H2,1-2H3 |
| InChIKey | WXCVZXZNCSCEFF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |