C21H37N3O — CID 10132455
(3aR,7aS)-3-[1-(cyclooctylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one (PubChem CID 10132455) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is (3aR,7aS)-3-[1-(cyclooctylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one.
| Compound Name | (3aR,7aS)-3-[1-(cyclooctylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 10132455 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | (3aR,7aS)-3-[1-(cyclooctylmethyl)piperidin-4-yl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-one |
| SMILES | O=C1N[C@H]2CCCC[C@H]2N1C1CCN(CC2CCCCCCC2)CC1 |
| InChI | InChI=1S/C21H37N3O/c25-21-22-19-10-6-7-11-20(19)24(21)18-12-14-23(15-13-18)16-17-8-4-2-1-3-5-9-17/h17-20H,1-16H2,(H,22,25)/t19-,20+/m0/s1 |
| InChIKey | VSHAXDNWFQCNEL-VQTJNVASSA-N |
| XLogP | 4.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |