About 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline
5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline (PubChem CID 10132549) has the molecular formula C17H20FN3O2S
and a molecular weight of 349.43 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline.
Molecular Properties
| Compound Name | 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline |
| PubChem CID | 10132549 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline |
| SMILES | Nc1cc(N2CCCNCC2)ccc1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H20FN3O2S/c18-13-3-1-4-15(11-13)24(22,23)17-6-5-14(12-16(17)19)21-9-2-7-20-8-10-21/h1,3-6,11-12,20H,2,7-10,19H2 |
| InChIKey | DXFJNQPSRPSTND-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline?
The IUPAC name of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline (CID 10132549) is 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline.
What is the SMILES notation for 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline?
The canonical SMILES for 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline is Nc1cc(N2CCCNCC2)ccc1S(=O)(=O)c1cccc(F)c1.
What is the InChIKey of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline?
The InChIKey is DXFJNQPSRPSTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FN3O2S/c18-13-3-1-4-15(11-13)24(22,23)17-6-5-14(12-16(17)19)21-9-2-7-20-8-10-21/h1,3-6,11-12,20H,2,7-10,19H2.
What are the key properties of 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline?
5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline has a molecular weight of 349.43 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-diazepan-1-yl)-2-(3-fluorophenyl)sulfonylaniline is sourced from PubChem (CID 10132549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).