About hexyl 3-heptoxypropanoate
hexyl 3-heptoxypropanoate (PubChem CID 101325522) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is hexyl 3-heptoxypropanoate.
Molecular Properties
| Compound Name | hexyl 3-heptoxypropanoate |
| PubChem CID | 101325522 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | hexyl 3-heptoxypropanoate |
| SMILES | CCCCCCCOCCC(=O)OCCCCCC |
| InChI | InChI=1S/C16H32O3/c1-3-5-7-9-10-13-18-15-12-16(17)19-14-11-8-6-4-2/h3-15H2,1-2H3 |
| InChIKey | QTKYUZODWYOKQN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 3-heptoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 3-heptoxypropanoate?
The IUPAC name of hexyl 3-heptoxypropanoate (CID 101325522) is hexyl 3-heptoxypropanoate.
What is the SMILES notation for hexyl 3-heptoxypropanoate?
The canonical SMILES for hexyl 3-heptoxypropanoate is CCCCCCCOCCC(=O)OCCCCCC.
What is the InChIKey of hexyl 3-heptoxypropanoate?
The InChIKey is QTKYUZODWYOKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-3-5-7-9-10-13-18-15-12-16(17)19-14-11-8-6-4-2/h3-15H2,1-2H3.
What are the key properties of hexyl 3-heptoxypropanoate?
hexyl 3-heptoxypropanoate has a molecular weight of 272.43 g/mol, XLogP of 4.49, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 3-heptoxypropanoate is sourced from PubChem (CID 101325522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).