C20H36N3O2+ — CID 101325705
2-[1-(2-aminoethyl)-2-[(E)-tridec-8-enyl]imidazol-1-ium-1-yl]acetic acid (PubChem CID 101325705) has the molecular formula C20H36N3O2+ and a molecular weight of 350.53 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)-2-[(E)-tridec-8-enyl]imidazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-(2-aminoethyl)-2-[(E)-tridec-8-enyl]imidazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 101325705 |
| Molecular Formula | C20H36N3O2+ |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 2-[1-(2-aminoethyl)-2-[(E)-tridec-8-enyl]imidazol-1-ium-1-yl]acetic acid |
| SMILES | CCCC/C=C/CCCCCCCC1=NC=C[N+]1(CCN)CC(=O)O |
| InChI | InChI=1S/C20H35N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-19-22-15-17-23(19,16-14-21)18-20(24)25/h5-6,15,17H,2-4,7-14,16,18,21H2,1H3/p+1/b6-5+ |
| InChIKey | IRQDYMWPXVJQSE-AATRIKPKSA-O |
| XLogP | 4.21 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|