C18H29N3O4 — CID 10132648
2-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N,N-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 10132648) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N,N-dimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N,N-dimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10132648 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N,N-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1coc([C@H](CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C18H29N3O4/c1-21(2)18(23)15-12-25-17(19-15)14(11-16(22)20-24)10-6-9-13-7-4-3-5-8-13/h12-14,24H,3-11H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | XCNVYYDGOWJOOG-CQSZACIVSA-N |
| XLogP | 3.11 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|