C19H19Cl2N3O4 — CID 101326966
N-(2-chloro-4,6-dimethoxyphenyl)-2-[(2-chloro-3-methylphenyl)diazenyl]-3-oxobutanamide (PubChem CID 101326966) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethoxyphenyl)-2-[(2-chloro-3-methylphenyl)diazenyl]-3-oxobutanamide.
| Compound Name | N-(2-chloro-4,6-dimethoxyphenyl)-2-[(2-chloro-3-methylphenyl)diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 101326966 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-(2-chloro-4,6-dimethoxyphenyl)-2-[(2-chloro-3-methylphenyl)diazenyl]-3-oxobutanamide |
| SMILES | COc1cc(Cl)c(NC(=O)C(/N=N/c2cccc(C)c2Cl)C(C)=O)c(OC)c1 |
| InChI | InChI=1S/C19H19Cl2N3O4/c1-10-6-5-7-14(16(10)21)23-24-17(11(2)25)19(26)22-18-13(20)8-12(27-3)9-15(18)28-4/h5-9,17H,1-4H3,(H,22,26)/b24-23+ |
| InChIKey | LURCPUZFAHAZCE-WCWDXBQESA-N |
| XLogP | 5.00 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|