C15H30N2O — CID 101327445
2-(2-decyl-2,4-dihydroimidazol-3-yl)ethanol (PubChem CID 101327445) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-(2-decyl-2,4-dihydroimidazol-3-yl)ethanol.
| Compound Name | 2-(2-decyl-2,4-dihydroimidazol-3-yl)ethanol |
|---|---|
| PubChem CID | 101327445 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-(2-decyl-2,4-dihydroimidazol-3-yl)ethanol |
| SMILES | CCCCCCCCCCC1N=CCN1CCO |
| InChI | InChI=1S/C15H30N2O/c1-2-3-4-5-6-7-8-9-10-15-16-11-12-17(15)13-14-18/h11,15,18H,2-10,12-14H2,1H3 |
| InChIKey | GEEKUFBESLCHQG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|