About 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol
2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol (PubChem CID 101327760) has the molecular formula C22H42N2O
and a molecular weight of 350.59 g/mol. Its IUPAC name is 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol |
| PubChem CID | 101327760 |
| Molecular Formula | C22H42N2O |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.33 |
| IUPAC Name | 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol |
| SMILES | C=CCCCCCCCCCCCCCCCC1=NCCN1CCO |
| InChI | InChI=1S/C22H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25/h2,25H,1,3-21H2 |
| InChIKey | FYUVBXZAFACZJN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol?
The IUPAC name of 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol (CID 101327760) is 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol.
What is the SMILES notation for 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol?
The canonical SMILES for 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol is C=CCCCCCCCCCCCCCCCC1=NCCN1CCO.
What is the InChIKey of 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol?
The InChIKey is FYUVBXZAFACZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25/h2,25H,1,3-21H2.
What are the key properties of 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol?
2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol has a molecular weight of 350.59 g/mol, XLogP of 5.73, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-heptadec-16-enyl-4,5-dihydroimidazol-1-yl)ethanol is sourced from PubChem (CID 101327760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).