About 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid
4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid (PubChem CID 10132781) has the molecular formula C20H35NO4
and a molecular weight of 353.50 g/mol. Its IUPAC name is 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid.
Molecular Properties
| Compound Name | 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid |
| PubChem CID | 10132781 |
| Molecular Formula | C20H35NO4 |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid |
| SMILES | CCCCC[C@@H]1C[C@H]1NC(=O)C1(CC(CCOC)C(=O)O)CCCC1 |
| InChI | InChI=1S/C20H35NO4/c1-3-4-5-8-15-13-17(15)21-19(24)20(10-6-7-11-20)14-16(18(22)23)9-12-25-2/h15-17H,3-14H2,1-2H3,(H,21,24)(H,22,23)/t15-,16?,17-/m1/s1 |
| InChIKey | BINPFDWVPOZRNS-PWZMFNOBSA-N |
| XLogP | 3.76 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid?
The IUPAC name of 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid (CID 10132781) is 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid.
What is the SMILES notation for 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid?
The canonical SMILES for 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid is CCCCC[C@@H]1C[C@H]1NC(=O)C1(CC(CCOC)C(=O)O)CCCC1.
What is the InChIKey of 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid?
The InChIKey is BINPFDWVPOZRNS-PWZMFNOBSA-N. The full InChI is InChI=1S/C20H35NO4/c1-3-4-5-8-15-13-17(15)21-19(24)20(10-6-7-11-20)14-16(18(22)23)9-12-25-2/h15-17H,3-14H2,1-2H3,(H,21,24)(H,22,23)/t15-,16?,17-/m1/s1.
What are the key properties of 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid?
4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid has a molecular weight of 353.50 g/mol, XLogP of 3.76, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-[[1-[[(1R,2R)-2-pentylcyclopropyl]carbamoyl]cyclopentyl]methyl]butanoic acid is sourced from PubChem (CID 10132781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).