C14H18BaO4 — CID 101328275
barium(2+);1-methyl-4-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 101328275) has the molecular formula C14H18BaO4 and a molecular weight of 387.62 g/mol. Its IUPAC name is barium(2+);1-methyl-4-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | barium(2+);1-methyl-4-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101328275 |
| Molecular Formula | C14H18BaO4 |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | barium(2+);1-methyl-4-propan-2-ylbicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)C12C=CC(C)(CC1)C(C(=O)[O-])C2C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/C14H20O4.Ba/c1-8(2)14-6-4-13(3,5-7-14)9(11(15)16)10(14)12(17)18;/h4,6,8-10H,5,7H2,1-3H3,(H,15,16)(H,17,18);/q;+2/p-2 |
| InChIKey | BVPUOLYKZRAWOP-UHFFFAOYSA-L |
| XLogP | -0.65 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|