About (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol
(1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol (PubChem CID 10132882) has the molecular formula C19H21N3O2S
and a molecular weight of 355.46 g/mol. Its IUPAC name is (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol.
Molecular Properties
| Compound Name | (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol |
| PubChem CID | 10132882 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol |
| SMILES | Cc1nc(-c2ccc(OCCNC[C@H](O)c3cccnc3)cc2)cs1 |
| InChI | InChI=1S/C19H21N3O2S/c1-14-22-18(13-25-14)15-4-6-17(7-5-15)24-10-9-21-12-19(23)16-3-2-8-20-11-16/h2-8,11,13,19,21,23H,9-10,12H2,1H3/t19-/m0/s1 |
| InChIKey | MPBSKGHZYFSSQJ-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol?
The IUPAC name of (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol (CID 10132882) is (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol.
What is the SMILES notation for (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol?
The canonical SMILES for (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol is Cc1nc(-c2ccc(OCCNC[C@H](O)c3cccnc3)cc2)cs1.
What is the InChIKey of (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol?
The InChIKey is MPBSKGHZYFSSQJ-IBGZPJMESA-N. The full InChI is InChI=1S/C19H21N3O2S/c1-14-22-18(13-25-14)15-4-6-17(7-5-15)24-10-9-21-12-19(23)16-3-2-8-20-11-16/h2-8,11,13,19,21,23H,9-10,12H2,1H3/t19-/m0/s1.
What are the key properties of (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol?
(1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol has a molecular weight of 355.46 g/mol, XLogP of 3.22, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]ethylamino]-1-pyridin-3-ylethanol is sourced from PubChem (CID 10132882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).