C22H25Cl2N3O6 — CID 101328909
N-chloro-2-[(3-chloro-2,5-dimethoxyphenyl)diazenyl]-N-(3,4-diethoxyphenyl)-3-oxobutanamide (PubChem CID 101328909) has the molecular formula C22H25Cl2N3O6 and a molecular weight of 498.36 g/mol. Its IUPAC name is N-chloro-2-[(3-chloro-2,5-dimethoxyphenyl)diazenyl]-N-(3,4-diethoxyphenyl)-3-oxobutanamide.
| Compound Name | N-chloro-2-[(3-chloro-2,5-dimethoxyphenyl)diazenyl]-N-(3,4-diethoxyphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 101328909 |
| Molecular Formula | C22H25Cl2N3O6 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-chloro-2-[(3-chloro-2,5-dimethoxyphenyl)diazenyl]-N-(3,4-diethoxyphenyl)-3-oxobutanamide |
| SMILES | CCOc1ccc(N(Cl)C(=O)C(/N=N/c2cc(OC)cc(Cl)c2OC)C(C)=O)cc1OCC |
| InChI | InChI=1S/C22H25Cl2N3O6/c1-6-32-18-9-8-14(10-19(18)33-7-2)27(24)22(29)20(13(3)28)26-25-17-12-15(30-4)11-16(23)21(17)31-5/h8-12,20H,6-7H2,1-5H3/b26-25+ |
| InChIKey | LRPKODBWIOPUOO-OCEACIFDSA-N |
| XLogP | 5.38 |
| TPSA | 99.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|