C20H21Cl2N3O6 — CID 101329158
N-(2-chloro-3,6-dimethoxyphenyl)-2-[(3-chloro-4,5-dimethoxyphenyl)diazenyl]-3-oxobutanamide (PubChem CID 101329158) has the molecular formula C20H21Cl2N3O6 and a molecular weight of 470.31 g/mol. Its IUPAC name is N-(2-chloro-3,6-dimethoxyphenyl)-2-[(3-chloro-4,5-dimethoxyphenyl)diazenyl]-3-oxobutanamide.
| Compound Name | N-(2-chloro-3,6-dimethoxyphenyl)-2-[(3-chloro-4,5-dimethoxyphenyl)diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 101329158 |
| Molecular Formula | C20H21Cl2N3O6 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-(2-chloro-3,6-dimethoxyphenyl)-2-[(3-chloro-4,5-dimethoxyphenyl)diazenyl]-3-oxobutanamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(/N=N/c2cc(Cl)c(OC)c(OC)c2)C(C)=O)c1Cl |
| InChI | InChI=1S/C20H21Cl2N3O6/c1-10(26)17(25-24-11-8-12(21)19(31-5)15(9-11)30-4)20(27)23-18-14(29-3)7-6-13(28-2)16(18)22/h6-9,17H,1-5H3,(H,23,27)/b25-24+ |
| InChIKey | SRMIVIFZVLVLCX-OCOZRVBESA-N |
| XLogP | 4.71 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|