C24H29Cl2N3O6 — CID 101329543
N-(2-chloro-4,5-diethoxyphenyl)-2-[(2-chloro-3,5-diethoxyphenyl)diazenyl]-3-oxobutanamide (PubChem CID 101329543) has the molecular formula C24H29Cl2N3O6 and a molecular weight of 526.42 g/mol. Its IUPAC name is N-(2-chloro-4,5-diethoxyphenyl)-2-[(2-chloro-3,5-diethoxyphenyl)diazenyl]-3-oxobutanamide.
| Compound Name | N-(2-chloro-4,5-diethoxyphenyl)-2-[(2-chloro-3,5-diethoxyphenyl)diazenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 101329543 |
| Molecular Formula | C24H29Cl2N3O6 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-(2-chloro-4,5-diethoxyphenyl)-2-[(2-chloro-3,5-diethoxyphenyl)diazenyl]-3-oxobutanamide |
| SMILES | CCOc1cc(/N=N/C(C(C)=O)C(=O)Nc2cc(OCC)c(OCC)cc2Cl)c(Cl)c(OCC)c1 |
| InChI | InChI=1S/C24H29Cl2N3O6/c1-6-32-15-10-18(22(26)21(11-15)35-9-4)28-29-23(14(5)30)24(31)27-17-13-20(34-8-3)19(33-7-2)12-16(17)25/h10-13,23H,6-9H2,1-5H3,(H,27,31)/b29-28+ |
| InChIKey | PTUSRFKNHKSLQA-ZQHSETAFSA-N |
| XLogP | 6.27 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|