C20H39N2O+ — CID 101330055
2-[3-ethyl-2-[(E)-tridec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol (PubChem CID 101330055) has the molecular formula C20H39N2O+ and a molecular weight of 323.55 g/mol. Its IUPAC name is 2-[3-ethyl-2-[(E)-tridec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol.
| Compound Name | 2-[3-ethyl-2-[(E)-tridec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 101330055 |
| Molecular Formula | C20H39N2O+ |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.31 |
| IUPAC Name | 2-[3-ethyl-2-[(E)-tridec-6-enyl]-1,2-dihydroimidazol-3-ium-3-yl]ethanol |
| SMILES | CCCCCC/C=C/CCCCCC1NC=C[N+]1(CC)CCO |
| InChI | InChI=1S/C20H39N2O/c1-3-5-6-7-8-9-10-11-12-13-14-15-20-21-16-17-22(20,4-2)18-19-23/h9-10,16-17,20-21,23H,3-8,11-15,18-19H2,1-2H3/q+1/b10-9+ |
| InChIKey | GOJMRCLROAMNSJ-MDZDMXLPSA-N |
| XLogP | 4.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|