About 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine
3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine (PubChem CID 10133066) has the molecular formula C17H9F4N5
and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 10133066 |
| Molecular Formula | C17H9F4N5 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine |
| SMILES | Fc1ccc(-c2cnc3nc(C(F)(F)F)ccn23)cc1-c1cccnn1 |
| InChI | InChI=1S/C17H9F4N5/c18-12-4-3-10(8-11(12)13-2-1-6-23-25-13)14-9-22-16-24-15(17(19,20)21)5-7-26(14)16/h1-9H |
| InChIKey | GXPAVMUVLDMPHC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine (CID 10133066) is 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine is Fc1ccc(-c2cnc3nc(C(F)(F)F)ccn23)cc1-c1cccnn1.
What is the InChIKey of 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
The InChIKey is GXPAVMUVLDMPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F4N5/c18-12-4-3-10(8-11(12)13-2-1-6-23-25-13)14-9-22-16-24-15(17(19,20)21)5-7-26(14)16/h1-9H.
What are the key properties of 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine?
3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine has a molecular weight of 359.29 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-3-pyridazin-3-ylphenyl)-7-(trifluoromethyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 10133066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).