C16H30N3O+ — CID 101330855
N-[1-(1-ethyl-2-hept-6-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide (PubChem CID 101330855) has the molecular formula C16H30N3O+ and a molecular weight of 280.44 g/mol. Its IUPAC name is N-[1-(1-ethyl-2-hept-6-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide.
| Compound Name | N-[1-(1-ethyl-2-hept-6-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 101330855 |
| Molecular Formula | C16H30N3O+ |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | N-[1-(1-ethyl-2-hept-6-enyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide |
| SMILES | C=CCCCCCC1=NCC[N+]1(CC)C(C)NC(C)=O |
| InChI | InChI=1S/C16H29N3O/c1-5-7-8-9-10-11-16-17-12-13-19(16,6-2)14(3)18-15(4)20/h5,14H,1,6-13H2,2-4H3/p+1 |
| InChIKey | GNYNKXMCZDFFBF-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|